Information card for entry 2235258
| Chemical name |
5-(4-Fluorophenyl)-3-[5-methyl-1-(4-methylphenyl)-1<i>H</i>-1,2,3-triazol- 4-yl]-4,5-dihydro-1<i>H</i>-pyrazole-1-carbothioamide |
| Formula |
C20 H19 F N6 S |
| Calculated formula |
C20 H19 F N6 S |
| SMILES |
S=C(N)N1N=C(CC1c1ccc(F)cc1)c1nnn(c1C)c1ccc(cc1)C |
| Title of publication |
5-(4-Fluorophenyl)-3-[5-methyl-1-(4-methylphenyl)-1<i>H</i>-1,2,3-triazol-4-yl]-4,5-dihydro-1<i>H</i>-pyrazole-1-carbothioamide |
| Authors of publication |
Abdel-Wahab, Bakr F.; Abdel-Latif, Ehab; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
6 |
| Pages of publication |
o1954 - o1955 |
| a |
9.4388 ± 0.0004 Å |
| b |
6.5476 ± 0.0003 Å |
| c |
32.1483 ± 0.0018 Å |
| α |
90° |
| β |
91.288 ± 0.004° |
| γ |
90° |
| Cell volume |
1986.31 ± 0.17 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0565 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.1011 |
| Weighted residual factors for all reflections included in the refinement |
0.1092 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235258.html