Information card for entry 2235363
| Chemical name |
Aqua(2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')(2-methylmalonato- κ^2^<i>O</i>^1^,<i>O</i>^3^)copper(II) dihydrate |
| Formula |
C14 H18 Cu N2 O7 |
| Calculated formula |
C14 H18 Cu N2 O7 |
| SMILES |
c1cccc2c3cccc[n]3[Cu]3([n]12)(OC(=O)C(C(=O)O3)C)[OH2].O.O |
| Title of publication |
Aqua(2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')(2-methylmalonato-κ^2^<i>O</i>^1^,<i>O</i>^3^)copper(II) dihydrate |
| Authors of publication |
Manochitra, P.; Manikandan, N.; Murugavel, S.; Sreeshailam, R.; Sambasiva Rao, P. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
m884 - m885 |
| a |
10.7588 ± 0.0007 Å |
| b |
7.4761 ± 0.0006 Å |
| c |
20.1029 ± 0.0013 Å |
| α |
90° |
| β |
90.917 ± 0.006° |
| γ |
90° |
| Cell volume |
1616.7 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0746 |
| Residual factor for significantly intense reflections |
0.0485 |
| Weighted residual factors for significantly intense reflections |
0.1046 |
| Weighted residual factors for all reflections included in the refinement |
0.1193 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.048 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235363.html