Information card for entry 2235458
| Chemical name |
3-(Adamantan-1-yl)-4-[(<i>E</i>)-(2,6-difluorobenzylidene)amino]-1-[(4- phenylpiperazin-1-yl)methyl]-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Formula |
C30 H34 F2 N6 S |
| Calculated formula |
C30 H34 F2 N6 S |
| SMILES |
S=C1N(/N=C/c2c(F)cccc2F)C(=NN1CN1CCN(CC1)c1ccccc1)C12CC3CC(CC(C1)C3)C2 |
| Title of publication |
3-(Adamantan-1-yl)-4-[(<i>E</i>)-(2,6-difluorobenzylidene)amino]-1-[(4-phenylpiperazin-1-yl)methyl]-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Authors of publication |
El-Emam, Ali A.; Al-Abdullah, Ebtehal S.; El-Brollosy, Nasser R.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
o2031 |
| a |
17.2712 ± 0.0003 Å |
| b |
7.7141 ± 0.0001 Å |
| c |
21.3157 ± 0.0004 Å |
| α |
90° |
| β |
95.245 ± 0.002° |
| γ |
90° |
| Cell volume |
2828.04 ± 0.08 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0649 |
| Residual factor for significantly intense reflections |
0.0533 |
| Weighted residual factors for significantly intense reflections |
0.1479 |
| Weighted residual factors for all reflections included in the refinement |
0.1607 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235458.html