Information card for entry 2235472
| Chemical name |
2-Methylsulfanyl-9<i>H</i>-1,3,4-thiadiazolo[2,3-<i>b</i>]quinazolin-9-one |
| Formula |
C10 H7 N3 O S2 |
| Calculated formula |
C10 H7 N3 O S2 |
| SMILES |
S1C2=Nc3c(C(=O)N2N=C1SC)cccc3 |
| Title of publication |
2-Methylsulfanyl-9<i>H</i>-1,3,4-thiadiazolo[2,3-<i>b</i>]quinazolin-9-one |
| Authors of publication |
El-Azab, Adel S.; Abdel-Aziz, Alaa A.-M.; Al-Swaidan, Ibrahim A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
o2134 |
| a |
11.8193 ± 0.0004 Å |
| b |
4.9841 ± 0.0002 Å |
| c |
17.4985 ± 0.0006 Å |
| α |
90° |
| β |
91.453 ± 0.003° |
| γ |
90° |
| Cell volume |
1030.48 ± 0.06 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0317 |
| Residual factor for significantly intense reflections |
0.029 |
| Weighted residual factors for significantly intense reflections |
0.0795 |
| Weighted residual factors for all reflections included in the refinement |
0.0817 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.087 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235472.html