Information card for entry 2235562
| Chemical name |
2-(3-Methoxyphenyl)-1,3-dihydro-1,3,2-benzodiazaborole |
| Formula |
C13 H13 B N2 O |
| Calculated formula |
C13 H13 B N2 O |
| SMILES |
O(c1cc(ccc1)B1Nc2c(N1)cccc2)C |
| Title of publication |
2-(3-Methoxyphenyl)-1,3-dihydro-1,3,2-benzodiazaborole |
| Authors of publication |
Robinson, Ross S.; Sithebe, Siphamandla; Akerman, Matthew P. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
o2241 |
| a |
7.549 ± 0.005 Å |
| b |
12.23 ± 0.005 Å |
| c |
12.308 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1136.3 ± 1 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0377 |
| Residual factor for significantly intense reflections |
0.0344 |
| Weighted residual factors for significantly intense reflections |
0.0928 |
| Weighted residual factors for all reflections included in the refinement |
0.094 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235562.html