Information card for entry 2235641
| Chemical name |
5-Chloro-3,6-dimethyl-1-phenyl-1<i>H</i>,4<i>H</i>- pyrano[2,3-<i>c</i>]pyrazol-4-one |
| Formula |
C14 H11 Cl N2 O2 |
| Calculated formula |
C14 H11 Cl N2 O2 |
| SMILES |
Clc1c(oc2n(nc(c2c1=O)C)c1ccccc1)C |
| Title of publication |
5-Chloro-3,6-dimethyl-1-phenyl-1<i>H</i>,4<i>H</i>-pyrano[2,3-<i>c</i>]pyrazol-4-one |
| Authors of publication |
Asiri, Abdullah M.; Faidallah, Hassan M.; Alamry, Khalid A.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
7 |
| Pages of publication |
o2257 |
| a |
11.8864 ± 0.0004 Å |
| b |
13.6276 ± 0.0005 Å |
| c |
31.0273 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
5025.9 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0606 |
| Residual factor for significantly intense reflections |
0.0444 |
| Weighted residual factors for significantly intense reflections |
0.1064 |
| Weighted residual factors for all reflections included in the refinement |
0.1173 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235641.html