Information card for entry 2235784
| Common name |
iodiconazole |
| Chemical name |
(2<i>RS</i>)-2-(2,4-Difluorophenyl)-1-[(4-iodobenzyl)(methyl)amino]- 3-(1<i>H</i>-1,2,4-triazol-1-yl)propan-2-ol |
| Formula |
C19 H19 F2 I N4 O |
| Calculated formula |
C19 H19 F2 I N4 O |
| SMILES |
Ic1ccc(cc1)CN(C)CC(O)(c1ccc(F)cc1F)Cn1ncnc1 |
| Title of publication |
(2<i>RS</i>)-2-(2,4-Difluorophenyl)-1-[(4-iodobenzyl)(methyl)amino]-3-(1<i>H</i>-1,2,4-triazol-1-yl)propan-2-ol |
| Authors of publication |
Xiong, Hui-Ping; Gao, Shou-Hong; Li, Chun-Tong; Wu, Zhi-Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2447 - o2448 |
| a |
34.398 ± 0.014 Å |
| b |
5.812 ± 0.002 Å |
| c |
21.619 ± 0.009 Å |
| α |
90° |
| β |
114.895 ± 0.005° |
| γ |
90° |
| Cell volume |
3920 ± 3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Cell measurement pressure |
1 kPa |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.045 |
| Residual factor for significantly intense reflections |
0.0394 |
| Weighted residual factors for significantly intense reflections |
0.0995 |
| Weighted residual factors for all reflections included in the refinement |
0.1029 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235784.html