Information card for entry 2235889
| Chemical name |
(<i>S</i>,<i>E</i>)-3-[(2-Hydroxybenzylidene)amino]-2-(2-hydroxyphenyl)- 2,3-dihydroquinazolin-4(1<i>H</i>)-one |
| Formula |
C21 H17 N3 O3 |
| Calculated formula |
C21 H17 N3 O3 |
| SMILES |
O=C1N(/N=C/c2ccccc2O)[C@H](Nc2ccccc12)c1ccccc1O |
| Title of publication |
(<i>S</i>,<i>E</i>)-3-[(2-Hydroxybenzylidene)amino]-2-(2-hydroxyphenyl)-2,3-dihydroquinazolin-4(1<i>H</i>)-one |
| Authors of publication |
Tinguiano, Daniel; Sy, Adama; Thiam, Ibrahima Elhadj; Gaye, Mohamed; Retailleau, Pascal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2374 - o2375 |
| a |
13.344 ± 0.015 Å |
| b |
10.693 ± 0.014 Å |
| c |
23.537 ± 0.013 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3358 ± 6 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
20 |
| Hermann-Mauguin space group symbol |
C 2 2 21 |
| Hall space group symbol |
C 2c 2 |
| Residual factor for all reflections |
0.0382 |
| Residual factor for significantly intense reflections |
0.0353 |
| Weighted residual factors for significantly intense reflections |
0.0944 |
| Weighted residual factors for all reflections included in the refinement |
0.0983 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.069 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235889.html