Information card for entry 2235898
| Chemical name |
(<i>R</i>)-2-Methyl-5-[(<i>R</i>)-2,4,4,4-tetrachlorobutan-2-yl]cyclohex-2-enone |
| Formula |
C11 H14 Cl4 O |
| Calculated formula |
C11 H14 Cl4 O |
| SMILES |
Cl[C@@]([C@H]1CC(=O)C(=CC1)C)(CC(Cl)(Cl)Cl)C |
| Title of publication |
(<i>R</i>)-2-Methyl-5-[(<i>R</i>)-2,4,4,4-tetrachlorobutan-2-yl]cyclohex-2-enone |
| Authors of publication |
Boualy, Brahim; Harrad, Mohamed Anouar; El Firdoussi, Larbi; Ali, Mustapha Ait; Stoeckli-Evans, Helen |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2451 - o2452 |
| a |
6.4976 ± 0.0006 Å |
| b |
13.3343 ± 0.0016 Å |
| c |
15.7648 ± 0.0014 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1365.9 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0486 |
| Residual factor for significantly intense reflections |
0.0285 |
| Weighted residual factors for significantly intense reflections |
0.0585 |
| Weighted residual factors for all reflections included in the refinement |
0.063 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.866 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235898.html