Information card for entry 2235947
| Chemical name |
<i>N</i>-(2-Fluorobenzyloxy)-1,3,5-trimethyl-2,6-diphenylpiperidin-4-imine |
| Formula |
C27 H29 F N2 O |
| Calculated formula |
C27 H29 F N2 O |
| SMILES |
Fc1ccccc1CON=C1[C@H]([C@@H](N([C@@H]([C@H]1C)c1ccccc1)C)c1ccccc1)C |
| Title of publication |
<i>N</i>-(2-Fluorobenzyloxy)-1,3,5-trimethyl-2,6-diphenylpiperidin-4-imine |
| Authors of publication |
Ramalingan, Chennan; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2312 - o2313 |
| a |
7.4004 ± 0.0003 Å |
| b |
22.4857 ± 0.0009 Å |
| c |
13.4465 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2237.54 ± 0.15 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0546 |
| Residual factor for significantly intense reflections |
0.0414 |
| Weighted residual factors for significantly intense reflections |
0.0907 |
| Weighted residual factors for all reflections included in the refinement |
0.1009 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235947.html