Information card for entry 2235959
| Chemical name |
Dimethyl 2-(24-acetyl-28-oxo-8,11,14-trioxa-24,27- diazapentacyclo[19.5.1.1^22,26^.0^2,7^.0^15,20^]octacosa- 2,4,6,15(20),16,18-hexaen-27-yl)but-2-enedioate |
| Formula |
C31 H34 N2 O9 |
| Calculated formula |
C31 H34 N2 O9 |
| SMILES |
[C@H]12c3ccccc3OCCOCCOc3ccccc3[C@H]([C@H]3CN(C[C@@H]1C3=O)C(=O)C)N2C(=C\C(=O)OC)\C(=O)OC |
| Title of publication |
Dimethyl 2-[24-acetyl-28-oxo-8,11,14-trioxa-24,27-diazapentacyclo[19.5.1.1^22,26^.0^2,7^.0^15,20^]octacosa-2,4,6,15(20),16,18-hexaen-27-yl]but-2-enedioate |
| Authors of publication |
Hieu, Truong Hong; Anh, Le Tuan; Soldatenkov, Anatoly T.; Kolyadina, Nadezhda M.; Khrustalev, Victor N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2431 - o2432 |
| a |
9.6634 ± 0.0006 Å |
| b |
26.3883 ± 0.0018 Å |
| c |
11.4375 ± 0.0008 Å |
| α |
90° |
| β |
99.614 ± 0.001° |
| γ |
90° |
| Cell volume |
2875.6 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0696 |
| Residual factor for significantly intense reflections |
0.0451 |
| Weighted residual factors for significantly intense reflections |
0.0989 |
| Weighted residual factors for all reflections included in the refinement |
0.1107 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235959.html