Information card for entry 2235961
| Chemical name |
1,4-Bis(4<i>H</i>-1,2,4-triazol-4-yl)benzene dihydrate |
| Formula |
C10 H12 N6 O2 |
| Calculated formula |
C10 H12 N6 O2 |
| SMILES |
n1ncn(c1)c1ccc(cc1)n1cnnc1.O.O |
| Title of publication |
1,4-Bis(4<i>H</i>-1,2,4-triazol-4-yl)benzene dihydrate |
| Authors of publication |
Wang, Xiu-Guang; Li, Jian-Hui; Ding, Bin; Du, Gui-Xiang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2394 |
| a |
3.709 ± 0.0007 Å |
| b |
15.68 ± 0.003 Å |
| c |
9.6054 ± 0.0018 Å |
| α |
90° |
| β |
99.748 ± 0.003° |
| γ |
90° |
| Cell volume |
550.56 ± 0.18 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0623 |
| Residual factor for significantly intense reflections |
0.0551 |
| Weighted residual factors for significantly intense reflections |
0.1252 |
| Weighted residual factors for all reflections included in the refinement |
0.1288 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.181 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2235961.html