Information card for entry 2236019
| Chemical name |
2,2-Diethyl 3,4-dimethyl 5-(4-cyanophenyl)pyrrolidine-2,2,3,4-tetracarboxylate |
| Formula |
C21 H24 N2 O8 |
| Calculated formula |
C21 H24 N2 O8 |
| SMILES |
O(C(=O)[C@@H]1[C@@H](NC([C@H]1C(=O)OC)(C(=O)OCC)C(=O)OCC)c1ccc(cc1)C#N)C |
| Title of publication |
2,2-Diethyl 3,4-dimethyl 5-(4-cyanophenyl)pyrrolidine-2,2,3,4-tetracarboxylate |
| Authors of publication |
He, Long |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
8 |
| Pages of publication |
o2363 |
| a |
8.472 ± 0.0002 Å |
| b |
10.3043 ± 0.0002 Å |
| c |
25.8774 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2259.05 ± 0.08 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0595 |
| Residual factor for significantly intense reflections |
0.05 |
| Weighted residual factors for significantly intense reflections |
0.1341 |
| Weighted residual factors for all reflections included in the refinement |
0.1413 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236019.html