Information card for entry 2236226
| Chemical name |
3-[(2-Chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-one |
| Formula |
C8 H10 Cl N3 O2 S |
| Calculated formula |
C8 H10 Cl N3 O2 S |
| SMILES |
s1c(CN2COCN(C2=O)C)cnc1Cl |
| Title of publication |
3-[(2-Chloro-1,3-thiazol-5-yl)methyl]-5-methyl-1,3,5-oxadiazinan-4-one |
| Authors of publication |
Kant, Rajni; Gupta, Vivek K.; Kapoor, Kamini; Shripanavar, Chetan S.; Banerjee, Kaushik |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
o3109 |
| a |
4.6141 ± 0.0002 Å |
| b |
11.7335 ± 0.0004 Å |
| c |
20.146 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1090.7 ± 0.07 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0361 |
| Residual factor for significantly intense reflections |
0.0314 |
| Weighted residual factors for significantly intense reflections |
0.0778 |
| Weighted residual factors for all reflections included in the refinement |
0.081 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236226.html