Information card for entry 2236390
| Chemical name |
6-(4-Methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| Formula |
C10 H11 N5 O |
| Calculated formula |
C10 H11 N5 O |
| SMILES |
O(c1ccc(c2nc(N)nc(N)n2)cc1)C |
| Title of publication |
6-(4-Methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| Authors of publication |
Thanigaimani, Kaliyaperumal; Razak, Ibrahim Abdul; Arshad, Suhana; Jagatheesan, Rathinavel; Santhanaraj, K. Joseph |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
o2910 |
| a |
7.434 ± 0.0002 Å |
| b |
10.0355 ± 0.0003 Å |
| c |
14.6803 ± 0.0004 Å |
| α |
90° |
| β |
114.191 ± 0.001° |
| γ |
90° |
| Cell volume |
999.03 ± 0.05 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0473 |
| Residual factor for significantly intense reflections |
0.0407 |
| Weighted residual factors for significantly intense reflections |
0.1152 |
| Weighted residual factors for all reflections included in the refinement |
0.1212 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236390.html