Information card for entry 2236462
| Common name |
<i>N</i>,<i>N</i>-Dibenzyl-<i>O</i>,<i>O</i>'-dimethyl thiophosphate |
| Formula |
C16 H20 N O2 P S |
| Calculated formula |
C16 H20 N O2 P S |
| SMILES |
COP(N(Cc1ccccc1)Cc1ccccc1)(OC)=S |
| Title of publication |
<i>N</i>,<i>N</i>-Dibenzyl-<i>O</i>,<i>O</i>'-dimethyl thiophosphate |
| Authors of publication |
Raissi Shabari, Akbar; Sabbaghi, Fahimeh; Pourayoubi, Mehrdad; Nečas, Marek; Babiak, Michal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
o3074 |
| a |
6.8377 ± 0.0003 Å |
| b |
8.1115 ± 0.0004 Å |
| c |
28.6187 ± 0.0016 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1587.31 ± 0.14 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0301 |
| Residual factor for significantly intense reflections |
0.0266 |
| Weighted residual factors for significantly intense reflections |
0.0631 |
| Weighted residual factors for all reflections included in the refinement |
0.0641 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.033 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236462.html