Information card for entry 2236605
| Chemical name |
Ethyl 2,4-dimethylpyrido[1,2-<i>a</i>]benzimidazole-3-carboxylate |
| Formula |
C16 H16 N2 O2 |
| Calculated formula |
C16 H16 N2 O2 |
| SMILES |
n1c2n(cc(c(C(=O)OCC)c2C)C)c2c1cccc2 |
| Title of publication |
Ethyl 2,4-dimethylpyrido[1,2-<i>a</i>]benzimidazole-3-carboxylate |
| Authors of publication |
Zhu, Ai Guo; Ma, Zhuo Ming; Li, Lin Jie; Wei, Tian Tian; Ge, Yan Qing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
10 |
| Pages of publication |
o3032 |
| a |
7.671 ± 0.004 Å |
| b |
13.174 ± 0.007 Å |
| c |
13.807 ± 0.007 Å |
| α |
90° |
| β |
102.68 ± 0.007° |
| γ |
90° |
| Cell volume |
1361.3 ± 1.2 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0523 |
| Residual factor for significantly intense reflections |
0.0465 |
| Weighted residual factors for significantly intense reflections |
0.1273 |
| Weighted residual factors for all reflections included in the refinement |
0.1339 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236605.html