Information card for entry 2236650
| Chemical name |
Di-<i>tert</i>-butyl <i>N</i>-{[1-(pyridin-4-yl)-1<i>H</i>-1,2,3-triazol-4-yl]methyl}iminodiacetate |
| Formula |
C20 H29 N5 O4 |
| Calculated formula |
C20 H29 N5 O4 |
| SMILES |
O(C(=O)CN(Cc1nnn(c1)c1ccncc1)CC(=O)OC(C)(C)C)C(C)(C)C |
| Title of publication |
Di-<i>tert</i>-butyl <i>N</i>-{[1-(pyridin-4-yl)-1<i>H</i>-1,2,3-triazol-4-yl]methyl}iminodiacetate |
| Authors of publication |
François, Alison; Marty, Louise; Picard, Claude; Mallet-Ladeira, Sonia; Benoist, Eric |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
o3162 |
| a |
9.1568 ± 0.0008 Å |
| b |
11.4452 ± 0.001 Å |
| c |
11.4928 ± 0.0011 Å |
| α |
90° |
| β |
110.84 ± 0.004° |
| γ |
90° |
| Cell volume |
1125.66 ± 0.18 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1306 |
| Residual factor for significantly intense reflections |
0.0585 |
| Weighted residual factors for significantly intense reflections |
0.1016 |
| Weighted residual factors for all reflections included in the refinement |
0.122 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.003 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236650.html