Information card for entry 2236741
| Chemical name |
Dibromido(6,6'-dimethyl-2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')cobalt(II) |
| Formula |
C12 H12 Br2 Co N2 |
| Calculated formula |
C12 H12 Br2 Co N2 |
| SMILES |
Cc1cccc2c3cccc(C)[n]3[Co]([n]12)(Br)Br |
| Title of publication |
Dibromido(6,6'-dimethyl-2,2'-bipyridine-κ^2^<i>N</i>,<i>N</i>')cobalt(II) |
| Authors of publication |
Shirvan, Sadif A.; Haydari Dezfuli, Sara; Khazali, Fereydoon; Aghajeri, Manouchehr; Borsalani, Ali |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
m1363 |
| a |
7.655 ± 0.0006 Å |
| b |
10.2577 ± 0.0009 Å |
| c |
18.003 ± 0.0016 Å |
| α |
90° |
| β |
95.779 ± 0.007° |
| γ |
90° |
| Cell volume |
1406.5 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0879 |
| Residual factor for significantly intense reflections |
0.0451 |
| Weighted residual factors for significantly intense reflections |
0.0807 |
| Weighted residual factors for all reflections included in the refinement |
0.0894 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.95 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236741.html