Information card for entry 2236763
| Chemical name |
[1-(5-Bromo-2-oxidobenzylidene)thiosemicarbazidato- κ^3^<i>O</i>,<i>N</i>^1^,<i>S</i>](pyridine-κ<i>N</i>)nickel(II) |
| Formula |
C13 H11 Br N4 Ni O S |
| Calculated formula |
C13 H11 Br N4 Ni O S |
| SMILES |
Brc1ccc2O[Ni]3([N](N=C(S3)N)=Cc2c1)[n]1ccccc1 |
| Title of publication |
[1-(5-Bromo-2-oxidobenzylidene)thiosemicarbazidato-κ^3^<i>O</i>,<i>N</i>^1^,<i>S</i>](pyridine-κ<i>N</i>)nickel(II) |
| Authors of publication |
Pederzolli, Fernanda Rosi Soares; Bresolin, Leandro; Beck, Johannes; Daniels, Jörg; de Oliveira, Adriano Bof |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
9 |
| Pages of publication |
m1138 |
| a |
12.2447 ± 0.0004 Å |
| b |
4.1135 ± 0.0001 Å |
| c |
31.138 ± 0.0011 Å |
| α |
90° |
| β |
112.646 ± 0.001° |
| γ |
90° |
| Cell volume |
1447.46 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0406 |
| Residual factor for significantly intense reflections |
0.0307 |
| Weighted residual factors for all reflections included in the refinement |
0.0831 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236763.html