Information card for entry 2236800
| Chemical name |
2,4,6-Tris(3,5-dimethyl-1<i>H</i>-pyrazol-1-yl)-1,3,5-triazine |
| Formula |
C18 H21 N9 |
| Calculated formula |
C18 H21 N9 |
| SMILES |
n1c(nc(nc1n1nc(cc1C)C)n1nc(cc1C)C)n1nc(cc1C)C |
| Title of publication |
A second polymorph of 2,4,6-tris(3,5-dimethyl-1<i>H</i>-pyrazol-1-yl)-1,3,5-triazine |
| Authors of publication |
Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
11 |
| Pages of publication |
o3201 |
| a |
7.184 ± 0.0001 Å |
| b |
12.5079 ± 0.0001 Å |
| c |
19.9527 ± 0.0001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1792.88 ± 0.03 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.028 |
| Residual factor for significantly intense reflections |
0.028 |
| Weighted residual factors for significantly intense reflections |
0.0789 |
| Weighted residual factors for all reflections included in the refinement |
0.079 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236800.html