Information card for entry 2236878
| Common name |
2,5-dihexyl-thiophene 1,1-dioxide |
| Chemical name |
2,5-Dihexylthiophene 1,1-dioxide |
| Formula |
C16 H28 O2 S |
| Calculated formula |
C16 H28 O2 S |
| SMILES |
S1(=O)(=O)C(=CC=C1CCCCCC)CCCCCC |
| Title of publication |
2,5-Dihexylthiophene 1,1-dioxide |
| Authors of publication |
Van Tonder, Johannes; Gohain, Mukut; Loganathan, Nagarajan; Bezuidenhoudt, Barend C. B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
12 |
| Pages of publication |
o3437 |
| a |
5.8249 ± 0.0011 Å |
| b |
11.248 ± 0.002 Å |
| c |
27.207 ± 0.006 Å |
| α |
90° |
| β |
91.77 ± 0.008° |
| γ |
90° |
| Cell volume |
1781.7 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0891 |
| Residual factor for significantly intense reflections |
0.0622 |
| Weighted residual factors for significantly intense reflections |
0.1499 |
| Weighted residual factors for all reflections included in the refinement |
0.1672 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2236878.html