Information card for entry 2237005
| Chemical name |
Bis[μ-<i>N</i>-(<i>tert</i>-butyldimethylsilyl)quinolin-8-aminato- 1:2κ^2^<i>N</i>^1^,<i>N</i>^8^:<i>N</i>^8^](<i>N</i>,<i>N</i>,<i>N</i>', <i>N</i>'-tetramethylethane-1,2-diamine-1κ^2^<i>N</i>,<i>N</i>')lithiumsodium |
| Formula |
C36 H58 Li N6 Na Si2 |
| Calculated formula |
C36 H58 Li N6 Na Si2 |
| SMILES |
[Li]123[n]4cccc5cccc(c45)[N]1([Na]1([N](C)(C)CC[N]1(C)C)[N]3(c1cccc3ccc[n]2c13)[Si](C)(C)C(C)(C)C)[Si](C)(C(C)(C)C)C |
| Title of publication |
Bis[μ-<i>N</i>-(<i>tert</i>-butyldimethylsilyl)quinolin-8-aminato-1:2κ^2^<i>N</i>^1^,<i>N</i>^8^:<i>N</i>^8^](<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-tetramethylethane-1,2-diamine-1κ^2^<i>N</i>,<i>N</i>')lithiumsodium |
| Authors of publication |
Chen, Juan; Yuan, Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
12 |
| Pages of publication |
m1474 |
| a |
12.653 ± 0.002 Å |
| b |
18.542 ± 0.003 Å |
| c |
18.296 ± 0.003 Å |
| α |
90° |
| β |
108.794 ± 0.003° |
| γ |
90° |
| Cell volume |
4063.6 ± 1.1 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1119 |
| Residual factor for significantly intense reflections |
0.0621 |
| Weighted residual factors for significantly intense reflections |
0.1734 |
| Weighted residual factors for all reflections included in the refinement |
0.1953 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.969 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237005.html