Information card for entry 2237538
| Chemical name |
4-Hydroxy-1,1'-bis[(<i>S</i>)-1-phenylethyl]-5,5',6,6'-tetrahydro-3,4'-bipyridine-2,2'(1<i>H</i>,1'<i>H</i>)-dione |
| Formula |
C26 H28 N2 O3 |
| Calculated formula |
C26 H28 N2 O3 |
| SMILES |
N1(C(=O)C(=C(O)CC1)C1=CC(=O)N(CC1)[C@@H](C)c1ccccc1)[C@@H](C)c1ccccc1 |
| Title of publication |
4-Hydroxy-1,1'-bis[(<i>S</i>)-1-phenylethyl]-5,5',6,6'-tetrahydro-3,4'-bipyridine-2,2'(1<i>H</i>,1'<i>H</i>)-dione |
| Authors of publication |
Romero, Nancy; Gnecco, Dino; Terán, Joel; Bernès, Sylvain |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
3 |
| Pages of publication |
o408 - o409 |
| a |
9.6647 ± 0.0013 Å |
| b |
9.7281 ± 0.001 Å |
| c |
23.684 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2226.7 ± 0.5 Å3 |
| Cell temperature |
296 ± 1 K |
| Ambient diffraction temperature |
296 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0533 |
| Residual factor for significantly intense reflections |
0.0387 |
| Weighted residual factors for significantly intense reflections |
0.0881 |
| Weighted residual factors for all reflections included in the refinement |
0.0953 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237538.html