Information card for entry 2237607
| Chemical name |
Ethyl 23-benzyl-8,11,14-trioxa-23,28,29-triazapentacyclo[19.7.1.0^2,7^.0^15,20^.0^22,27^]nonacosa-2,4,6,15(20),16,18,21,26-octaene-26-carboxylate |
| Formula |
C33 H35 N3 O5 |
| Calculated formula |
C33 H35 N3 O5 |
| SMILES |
[C@@H]12c3ccccc3OCCOCCOc3ccccc3C(=C3C(=C(CCN3Cc3ccccc3)C(=O)OCC)N1)N2 |
| Title of publication |
Ethyl 23-benzyl-8,11,14-trioxa-23,28,29-triazapentacyclo[19.7.1.0^2,7^.0^15,20^.0^22,27^]nonacosa-2,4,6,15(20),16,18,21,26-octaene-26-carboxylate |
| Authors of publication |
Hieu, Truong Hong; Anh, Le Tuan; Soldatenkov, Anatoly T.; Vasil'ev, Vasily G.; Khrustalev, Victor N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
4 |
| Pages of publication |
o565 - o566 |
| a |
10.5304 ± 0.0005 Å |
| b |
12.6363 ± 0.0005 Å |
| c |
10.7246 ± 0.0005 Å |
| α |
90° |
| β |
92.865 ± 0.001° |
| γ |
90° |
| Cell volume |
1425.29 ± 0.11 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.052 |
| Residual factor for significantly intense reflections |
0.0403 |
| Weighted residual factors for significantly intense reflections |
0.0887 |
| Weighted residual factors for all reflections included in the refinement |
0.0937 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237607.html