Information card for entry 2237642
| Chemical name |
(2-Amino-7-methyl-4-oxidopteridine-6-carboxylato-κ^3^<i>O</i>^4^,<i>N</i>^5^,<i>O</i>^6^)(ethane-1,2-diamine-κ^2^<i>N</i>,<i>N</i>')(1<i>H</i>-imidazole-κ<i>N</i>^3^)nickel(II) dihydrate |
| Formula |
C13 H21 N9 Ni O5 |
| Calculated formula |
C13 H21 N9 Ni O5 |
| SMILES |
[Ni]123(OC(=O)c4[n]1c1c(nc4C)nc(nc1O2)N)([NH2]CC[NH2]3)[n]1c[nH]cc1.O.O |
| Title of publication |
(2-Amino-7-methyl-4-oxidopteridine-6-carboxylato-κ^3^<i>O</i>^4^,<i>N</i>^5^,<i>O</i>^6^)(ethane-1,2-diamine-κ^2^<i>N</i>,<i>N</i>')(1<i>H</i>-imidazole-κ<i>N</i>^3^)nickel(II) dihydrate |
| Authors of publication |
Baisya, Siddhartha S.; Roy, Parag S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
4 |
| Pages of publication |
m193 - m194 |
| a |
13.484 ± 0.002 Å |
| b |
8.8741 ± 0.0015 Å |
| c |
29.959 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3584.8 ± 1 Å3 |
| Cell temperature |
293 K |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
5 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.0434 |
| Residual factor for significantly intense reflections |
0.0361 |
| Weighted residual factors for all reflections |
0.0908 |
| Weighted residual factors for significantly intense reflections |
0.0876 |
| Weighted residual factors for all reflections included in the refinement |
0.0908 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9447 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237642.html