Information card for entry 2237738
| Chemical name |
3,9-Dimethyl-2,3-dihydrospiro[carbazole-1,2'-[1,3]dithiolan]-4(9<i>H</i>)-one |
| Formula |
C16 H17 N O S2 |
| Calculated formula |
C16 H17 N O S2 |
| SMILES |
S1C2(SCC1)CC(C(=O)c1c3ccccc3n(c21)C)C |
| Title of publication |
3,9-Dimethyl-2,3-dihydrospiro[carbazole-1,2'-[1,3]dithiolan]-4(9<i>H</i>)-one |
| Authors of publication |
Gülle, Sibel; Çaylak Delibaş, Nagihan; Ergün, Yavuz; Hökelek, Tuncer |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
4 |
| Pages of publication |
o598 - o599 |
| a |
16.8163 ± 0.0003 Å |
| b |
9.8407 ± 0.0002 Å |
| c |
17.2913 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2861.44 ± 0.1 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0894 |
| Residual factor for significantly intense reflections |
0.0752 |
| Weighted residual factors for significantly intense reflections |
0.1849 |
| Weighted residual factors for all reflections included in the refinement |
0.1948 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237738.html