Information card for entry 2237856
| Chemical name |
3-[(4-Phenylpiperazin-1-yl)methyl]-5-(thiophen-2-yl)-2,3-dihydro-1,3,4-oxadiazole-2-thione |
| Formula |
C17 H18 N4 O S2 |
| Calculated formula |
C17 H18 N4 O S2 |
| SMILES |
S=C1OC(=NN1CN1CCN(CC1)c1ccccc1)c1cccs1 |
| Title of publication |
3-[(4-Phenylpiperazin-1-yl)methyl]-5-(thiophen-2-yl)-2,3-dihydro-1,3,4-oxadiazole-2-thione |
| Authors of publication |
El-Emam, Ali A.; Al-Omar, Mohamed A.; Al-Obaid, Abdul-Rahman M.; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
o684 |
| a |
26.1721 ± 0.0017 Å |
| b |
5.7253 ± 0.0003 Å |
| c |
23.7008 ± 0.0018 Å |
| α |
90° |
| β |
97.802 ± 0.006° |
| γ |
90° |
| Cell volume |
3518.5 ± 0.4 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0717 |
| Residual factor for significantly intense reflections |
0.0465 |
| Weighted residual factors for significantly intense reflections |
0.1053 |
| Weighted residual factors for all reflections included in the refinement |
0.1231 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237856.html