Information card for entry 2237977
| Chemical name |
Diethyl 4-(2-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Formula |
C20 H25 N O5 |
| Calculated formula |
C20 H25 N O5 |
| SMILES |
C1(C(=C(C)NC(=C1C(=O)OCC)C)C(=O)OCC)c1ccccc1OC |
| Title of publication |
Diethyl 4-(2-methoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Authors of publication |
Wang, Ke; Wang, Yifeng; Yao, Minjie; Xu, Danqian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
5 |
| Pages of publication |
o785 |
| a |
22.4689 ± 0.0007 Å |
| b |
22.4689 ± 0.0007 Å |
| c |
8.2443 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4162.1 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
114 |
| Hermann-Mauguin space group symbol |
P -4 21 c |
| Hall space group symbol |
P -4 2n |
| Residual factor for all reflections |
0.09 |
| Residual factor for significantly intense reflections |
0.0587 |
| Weighted residual factors for significantly intense reflections |
0.1472 |
| Weighted residual factors for all reflections included in the refinement |
0.1671 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2237977.html