Information card for entry 2238189
| Chemical name |
<i>catena</i>-Poly[(diaquacadmium)-μ-iminodiacetato-κ^4^<i>O</i>,<i>N</i>,<i>O</i>':<i>O</i>''] |
| Formula |
C4 H9 Cd N O6 |
| Calculated formula |
C4 H9 Cd N O6 |
| SMILES |
[Cd]12(OC(=O)C[NH]2CC(=O)O1)([OH2])([OH2])[O]=C1O[Cd]2(OC(=O)C[NH]2C1)([OH2])[OH2] |
| Title of publication |
<i>catena</i>-Poly[(diaquacadmium)-μ-iminodiacetato-κ^4^<i>O</i>,<i>N</i>,<i>O</i>':<i>O</i>''] |
| Authors of publication |
Pan, Gang-Hong; Tang, Jin-Niu; Huang, Zhong-Jing; Liao, Yi-Fan; Mo, Bo-Fa |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
7 |
| Pages of publication |
m416 |
| a |
14.66 ± 0.0003 Å |
| b |
5.4905 ± 0.0002 Å |
| c |
9.7928 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
788.23 ± 0.04 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0514 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for significantly intense reflections |
0.1605 |
| Weighted residual factors for all reflections included in the refinement |
0.1643 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.093 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238189.html