Information card for entry 2238630
| Chemical name |
<i>N</i>,<i>N</i>'-(2-Hydroxypropane-1,3-diyl)bis(2-hydroxybenzamide) monohydrate |
| Formula |
C17 H20 N2 O6 |
| Calculated formula |
C17 H20 N2 O6 |
| SMILES |
OC(CNC(=O)c1ccccc1O)CNC(=O)c1ccccc1O.O |
| Title of publication |
<i>N</i>,<i>N</i>'-(2-Hydroxypropane-1,3-diyl)bis(2-hydroxybenzamide) monohydrate |
| Authors of publication |
Yebedri, Sihem; Louhibi, Samira; Bouacida, Sofiane; Ourari, Ali; Roisnel, Thierry |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
10 |
| Pages of publication |
o1591 |
| a |
12.8969 ± 0.001 Å |
| b |
28.001 ± 0.002 Å |
| c |
4.533 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1637 ± 0.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
62 |
| Hermann-Mauguin space group symbol |
P n m a |
| Hall space group symbol |
-P 2ac 2n |
| Residual factor for all reflections |
0.0906 |
| Residual factor for significantly intense reflections |
0.0478 |
| Weighted residual factors for significantly intense reflections |
0.1058 |
| Weighted residual factors for all reflections included in the refinement |
0.1231 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238630.html