Information card for entry 2238758
| Chemical name |
6-(3,5-Dimethyl-1<i>H</i>-pyrazol-1-yl)-1,2,4,5-tetrazin-3(2<i>H</i>)-one |
| Formula |
C7 H8 N6 O |
| Calculated formula |
C7 H8 N6 O |
| SMILES |
O=c1[nH]nc(n2nc(cc2C)C)nn1 |
| Title of publication |
6-(3,5-Dimethyl-1<i>H</i>-pyrazol-1-yl)-1,2,4,5-tetrazin-3(2<i>H</i>)-one |
| Authors of publication |
Suponitsky, Kyrill Yu.; Chernyshev, Victor M.; Mazharova, Anna G.; Palysaeva, Nadezhda V.; Sheremetev, Aleksei B. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2013 |
| Journal volume |
69 |
| Journal issue |
11 |
| Pages of publication |
o1630 - o1631 |
| a |
12.1431 ± 0.0011 Å |
| b |
12.6551 ± 0.0012 Å |
| c |
5.3907 ± 0.0005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
828.4 ± 0.13 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0436 |
| Residual factor for significantly intense reflections |
0.0371 |
| Weighted residual factors for significantly intense reflections |
0.0896 |
| Weighted residual factors for all reflections included in the refinement |
0.0938 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2238758.html