Information card for entry 2239018
| Chemical name |
<i>N</i>-Phenyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylidene)hydrazinecarbothioamide |
| Formula |
C17 H17 N3 S |
| Calculated formula |
C17 H17 N3 S |
| SMILES |
S=C(Nc1ccccc1)N/N=C1\CCCc2c1cccc2 |
| Title of publication |
<i>N</i>-Phenyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylidene)hydrazinecarbothioamide |
| Authors of publication |
de Oliveira, Adriano Bof; Feitosa, Bárbara Regina Santos; Näther, Christian; Jess, Inke |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o205 |
| a |
8.4415 ± 0.0003 Å |
| b |
18.0256 ± 0.0007 Å |
| c |
10.026 ± 0.0003 Å |
| α |
90° |
| β |
107.495 ± 0.002° |
| γ |
90° |
| Cell volume |
1455.02 ± 0.09 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0454 |
| Residual factor for significantly intense reflections |
0.0358 |
| Weighted residual factors for significantly intense reflections |
0.0847 |
| Weighted residual factors for all reflections included in the refinement |
0.0889 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239018.html