Information card for entry 2239044
| Common name |
1-(2,4-Dinitrophenyl)-2-[(<i>E</i>)-(3,4,5-trimethoxybenzylidene)]hydrazine |
| Chemical name |
1-(2,4-Dinitrophenyl)-2-[(<i>E</i>)-(3,4,5-trimethoxybenzylidene)]hydrazine |
| Formula |
C16 H16 N4 O7 |
| Calculated formula |
C16 H16 N4 O7 |
| SMILES |
O=N(=O)c1c(N/N=C/c2cc(OC)c(OC)c(OC)c2)ccc(N(=O)=O)c1 |
| Title of publication |
1-(2,4-Dinitrophenyl)-2-[(<i>E</i>)-(3,4,5-trimethoxybenzylidene)]hydrazine |
| Authors of publication |
Chantrapromma, Suchada; Ruanwas, Pumsak; Boonnak, Nawong; Chidan Kumar, C. S.; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
2 |
| Pages of publication |
o188 - o189 |
| a |
7.4724 ± 0.0004 Å |
| b |
14.3106 ± 0.0007 Å |
| c |
16.1549 ± 0.0007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1727.52 ± 0.15 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0663 |
| Residual factor for significantly intense reflections |
0.0476 |
| Weighted residual factors for significantly intense reflections |
0.0989 |
| Weighted residual factors for all reflections included in the refinement |
0.1072 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.083 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239044.html