Information card for entry 2239148
| Chemical name |
Ethyl 6-methyl-2-oxo-4-[4-(1<i>H</i>-tetrazol-5-yl)phenyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate–dimethylformamide–water (2/1/1) |
| Formula |
C16.5 H20.5 N6.5 O4 |
| Calculated formula |
C16.5 H20.5 N6.5 O4 |
| SMILES |
CC1=C(C(c2ccc(cc2)c2nnn[nH]2)NC(=O)N1)C(=O)OCC.CN(C)C=O.O |
| Title of publication |
Ethyl 6-methyl-2-oxo-4-[4-(1<i>H</i>-tetrazol-5-yl)phenyl]-1,2,3,4-tetrahydropyrimidine-5-carboxylate–dimethylformamide–water (2/1/1) |
| Authors of publication |
Ouyang, Hua-Yong; Chang, Yi-Qi; Zhao, Lu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
1 |
| Pages of publication |
o1 - o2 |
| a |
10.198 ± 0.002 Å |
| b |
13.262 ± 0.003 Å |
| c |
13.771 ± 0.003 Å |
| α |
81.14 ± 0.03° |
| β |
73.32 ± 0.03° |
| γ |
81.14 ± 0.03° |
| Cell volume |
1750.9 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0879 |
| Residual factor for significantly intense reflections |
0.0587 |
| Weighted residual factors for significantly intense reflections |
0.1426 |
| Weighted residual factors for all reflections included in the refinement |
0.1571 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.116 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239148.html