Information card for entry 2239310
| Chemical name |
(1<i>R</i>,4<i>R</i>,6<i>S</i>,7<i>R</i>)-5,5-Dibromo-1,4,8,8-tetramethyltricyclo[5.4.1.0^4,6^]dodecan-12-one |
| Formula |
C16 H24 Br2 O |
| Calculated formula |
C16 H24 Br2 O |
| SMILES |
O=C1[C@@H]2[C@@H]3C([C@@]3(CC[C@@]1(C)CCCC2(C)C)C)(Br)Br |
| Title of publication |
(1<i>R</i>,4<i>R</i>,6<i>S</i>,7<i>R</i>)-5,5-Dibromo-1,4,8,8-tetramethyltricyclo[5.4.1.0^4,6^]dodecan-12-one |
| Authors of publication |
Zaki, Mohamed; Benharref, Ahmed; Daran, Jean-Claude; Berraho, Moha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
5 |
| Pages of publication |
o526 |
| a |
6.655 ± 0.0003 Å |
| b |
9.4142 ± 0.0004 Å |
| c |
12.9389 ± 0.0013 Å |
| α |
86.008 ± 0.006° |
| β |
83.921 ± 0.006° |
| γ |
89.511 ± 0.004° |
| Cell volume |
804.13 ± 0.1 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.0717 |
| Residual factor for significantly intense reflections |
0.0537 |
| Weighted residual factors for significantly intense reflections |
0.1082 |
| Weighted residual factors for all reflections included in the refinement |
0.1185 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.007 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239310.html