Information card for entry 2239665
| Chemical name |
6-[(2-Methylphenyl)sulfanyl]-5-propylpyrimidine-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Formula |
C14 H16 N2 O2 S |
| Calculated formula |
C14 H16 N2 O2 S |
| SMILES |
S(c1ccccc1C)C1NC(=O)NC(=O)C=1CCC |
| Title of publication |
6-[(2-Methylphenyl)sulfanyl]-5-propylpyrimidine-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Authors of publication |
Haress, Nadia G.; Ghabbour, Hazem A.; El-Emam, Ali A.; Chidan Kumar, C. S.; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
7 |
| Pages of publication |
o768 - o769 |
| a |
10.3434 ± 0.0008 Å |
| b |
5.3355 ± 0.0003 Å |
| c |
24.4948 ± 0.0018 Å |
| α |
90° |
| β |
91.171 ± 0.003° |
| γ |
90° |
| Cell volume |
1351.52 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1009 |
| Residual factor for significantly intense reflections |
0.0627 |
| Weighted residual factors for significantly intense reflections |
0.1231 |
| Weighted residual factors for all reflections included in the refinement |
0.1342 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.079 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239665.html