Information card for entry 2239671
| Chemical name |
3-(4-Fluorophenylsulfinyl)-2,4,5,6-tetramethyl-1-benzofuran |
| Formula |
C18 H17 F O2 S |
| Calculated formula |
C18 H17 F O2 S |
| SMILES |
S(=O)(c1c2c(c(c(cc2oc1C)C)C)C)c1ccc(F)cc1 |
| Title of publication |
3-(4-Fluorophenylsulfinyl)-2,4,5,6-tetramethyl-1-benzofuran |
| Authors of publication |
Choi, Hong Dae; Seo, Pil Ja; Lee, Uk |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
7 |
| Pages of publication |
o830 |
| a |
7.8869 ± 0.0002 Å |
| b |
11.0042 ± 0.0002 Å |
| c |
17.5181 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1520.38 ± 0.06 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0436 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for significantly intense reflections |
0.0912 |
| Weighted residual factors for all reflections included in the refinement |
0.0941 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.051 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239671.html