Information card for entry 2239793
| Chemical name |
2,6-Dibromo-<i>N</i>,<i>N</i>-bis(4-nitrophenyl)aniline |
| Formula |
C18 H11 Br2 N3 O4 |
| Calculated formula |
C18 H11 Br2 N3 O4 |
| SMILES |
Brc1c(N(c2ccc(N(=O)=O)cc2)c2ccc(N(=O)=O)cc2)c(Br)ccc1 |
| Title of publication |
Isotypic crystal structures of 2,6-dibromo-<i>N</i>,<i>N</i>-bis(4-nitrophenyl)aniline and 2,6-dichloro-<i>N</i>,<i>N</i>-bis(4-nitrophenyl)aniline |
| Authors of publication |
Kautny, Paul; Fröhlich, Johannes; Stöger, Berthold; Weil, Matthias |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
8 |
| Pages of publication |
65 - 67 |
| a |
13.4705 ± 0.0007 Å |
| b |
11.6686 ± 0.0006 Å |
| c |
11.7081 ± 0.0007 Å |
| α |
90° |
| β |
107.576 ± 0.002° |
| γ |
90° |
| Cell volume |
1754.39 ± 0.17 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0592 |
| Residual factor for significantly intense reflections |
0.0335 |
| Weighted residual factors for significantly intense reflections |
0.0725 |
| Weighted residual factors for all reflections included in the refinement |
0.079 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.36 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239793.html