Information card for entry 2239975
| Chemical name |
5,5'-[(4-Fluorophenyl)methylene]bis[6-amino-1,3-dimethylpyrimidine-2,4(1<i>H</i>,3<i>H</i>)-dione] |
| Formula |
C19 H21 F N6 O4 |
| Calculated formula |
C19 H21 F N6 O4 |
| SMILES |
O=C1N(C(=O)N(C(=C1C(C1=C(N(C(=O)N(C1=O)C)C)N)c1ccc(F)cc1)N)C)C |
| Title of publication |
Crystal structure of 5,5'-[(4-fluorophenyl)methylene]bis[6-amino-1,3-dimethylpyrimidine-2,4(1<i>H</i>,3<i>H</i>)-dione] |
| Authors of publication |
Sharma, Naresh; Brahmachari, Goutam; Banerjee, Bubun; Kant, Rajni; Gupta, Vivek K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
10 |
| Pages of publication |
o1098 - o1099 |
| a |
14.6208 ± 0.0006 Å |
| b |
11.3324 ± 0.0007 Å |
| c |
22.641 ± 0.0012 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3751.4 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.0976 |
| Residual factor for significantly intense reflections |
0.052 |
| Weighted residual factors for significantly intense reflections |
0.1057 |
| Weighted residual factors for all reflections included in the refinement |
0.1301 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2239975.html