Information card for entry 2240082
| Chemical name |
Bis{2-[(2-hydroxyethyl)amino]ethanol-κ^3^<i>O</i>,<i>N</i>,<i>O</i>'}copper(II) terephthalate |
| Formula |
C16 H26 Cu N2 O8 |
| Calculated formula |
C16 H26 Cu N2 O8 |
| SMILES |
C(=O)(c1ccc(C(=O)[O-])cc1)[O-].C1[OH][Cu]234([NH](C1)CC[OH]3)[NH](CC[OH]2)CC[OH]4 |
| Title of publication |
Crystal structure of bis{2-[(2-hydroxyethyl)amino]ethanol-κ^3^<i>O</i>,<i>N</i>,<i>O</i>'}copper(II) terephthalate |
| Authors of publication |
Li, Ya-Ping; Sun, Dajun; Ming, Julia; Han, Liying; Su, Guan-Fang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2014 |
| Journal volume |
70 |
| Journal issue |
11 |
| Pages of publication |
m372 - m373 |
| a |
8.6013 ± 0.0009 Å |
| b |
9.0398 ± 0.0009 Å |
| c |
11.5732 ± 0.0012 Å |
| α |
90° |
| β |
91.695 ± 0.002° |
| γ |
90° |
| Cell volume |
899.47 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0327 |
| Residual factor for significantly intense reflections |
0.03 |
| Weighted residual factors for significantly intense reflections |
0.0786 |
| Weighted residual factors for all reflections included in the refinement |
0.0798 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240082.html