Information card for entry 2240320
| Chemical name |
(1<i>S</i>,2<i>R</i>,4<i>S</i>)-1-[(Morpholin-4-yl)methyl]-4-(prop-1-en-2-yl)cyclohexane-1,2-diol |
| Formula |
C14 H25 N O3 |
| Calculated formula |
C14 H25 N O3 |
| SMILES |
[C@@]1([C@@H](C[C@H](CC1)C(=C)C)O)(CN1CCOCC1)O |
| Title of publication |
Crystal structure of (1<i>S</i>,2<i>R</i>,4<i>S</i>)-1-[(morpholin-4-yl)methyl]-4-(prop-1-en-2-yl)cyclohexane-1,2-diol |
| Authors of publication |
Outouch, Rachid; Oubaassine, Saadia; Ait Ali, Mustapha; El Firdoussi, Larbi; Spannenberg, Anke |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
1 |
| Pages of publication |
79 - 81 |
| a |
6.33 ± 0.0001 Å |
| b |
22.0241 ± 0.0005 Å |
| c |
10.1179 ± 0.0002 Å |
| α |
90° |
| β |
95.2083 ± 0.0012° |
| γ |
90° |
| Cell volume |
1404.74 ± 0.05 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0326 |
| Residual factor for significantly intense reflections |
0.031 |
| Weighted residual factors for significantly intense reflections |
0.081 |
| Weighted residual factors for all reflections included in the refinement |
0.0823 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240320.html