Information card for entry 2240453
| Chemical name |
1-{2-[(2-Methoxyphenyl)selanyl]phenyl}-4-phenyl-1<i>H</i>-1,2,3-triazole |
| Formula |
C21 H17 N3 O Se |
| Calculated formula |
C21 H17 N3 O Se |
| SMILES |
[Se](c1c(OC)cccc1)c1ccccc1n1nnc(c1)c1ccccc1 |
| Title of publication |
Crystal structure of 1-{2-[(2-methoxyphenyl)selanyl]phenyl}-4-phenyl-1<i>H</i>-1,2,3-triazole |
| Authors of publication |
Camargo, Leandro R. S.; Zukerman-Schpector, Julio; Deobald, Anna M.; Braga, Antonio L.; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
3 |
| Pages of publication |
o202 - o203 |
| a |
5.6565 ± 0.0003 Å |
| b |
10.3682 ± 0.0005 Å |
| c |
15.3358 ± 0.0007 Å |
| α |
81.604 ± 0.004° |
| β |
80.006 ± 0.004° |
| γ |
85.34 ± 0.004° |
| Cell volume |
874.83 ± 0.08 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0351 |
| Residual factor for significantly intense reflections |
0.0278 |
| Weighted residual factors for significantly intense reflections |
0.0612 |
| Weighted residual factors for all reflections included in the refinement |
0.0639 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.009 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240453.html