Information card for entry 2240457
| Chemical name |
Ethyl 6-methyl-2-oxo-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Formula |
C17 H22 N2 O6 |
| Calculated formula |
C17 H22 N2 O6 |
| SMILES |
c1(cc(c(c(c1)OC)OC)OC)C1C(=C(C)NC(=O)N1)C(=O)OCC |
| Title of publication |
Crystal structure of ethyl 6-methyl-2-oxo-4-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Novina, J. J.; Vasuki, G.; Suresh, M.; Padusha, M. Syed Ali |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
3 |
| Pages of publication |
o206 - o207 |
| a |
10.1447 ± 0.0003 Å |
| b |
10.1919 ± 0.0002 Å |
| c |
10.8724 ± 0.0002 Å |
| α |
117.882 ± 0.001° |
| β |
101.371 ± 0.001° |
| γ |
105.498 ± 0.001° |
| Cell volume |
886.4 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0596 |
| Residual factor for significantly intense reflections |
0.0497 |
| Weighted residual factors for significantly intense reflections |
0.1439 |
| Weighted residual factors for all reflections included in the refinement |
0.1542 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240457.html