Information card for entry 2240486
| Chemical name |
(5'<i>S</i>,8'<i>S</i>)-3-(2,5-Dimethylphenyl)-8-methoxy-3-nitro-1-azaspiro[4.5]decane-2,4-dione |
| Formula |
C18 H22 N2 O5 |
| Calculated formula |
C18 H22 N2 O5 |
| SMILES |
O=N(=O)C1(c2c(ccc(c2)C)C)C(=O)C2(NC1=O)CCC(OC)CC2 |
| Title of publication |
Crystal structure of (5'<i>S</i>,8'<i>S</i>)-3-(2,5-dimethylphenyl)-8-methoxy-3-nitro-1-azaspiro[4.5]decane-2,4-dione |
| Authors of publication |
Hu, Gao-Bo; Jiang, Da-Wei; Li, Jiang-Yan; Rao, Yan; Jiang, Li-Yuan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
4 |
| Pages of publication |
o238 - o239 |
| a |
9.5707 ± 0.0009 Å |
| b |
8.4181 ± 0.0007 Å |
| c |
22.872 ± 0.0019 Å |
| α |
90° |
| β |
100.703 ± 0.008° |
| γ |
90° |
| Cell volume |
1810.7 ± 0.3 Å3 |
| Cell temperature |
170.1 K |
| Ambient diffraction temperature |
170.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0662 |
| Residual factor for significantly intense reflections |
0.05 |
| Weighted residual factors for significantly intense reflections |
0.1259 |
| Weighted residual factors for all reflections included in the refinement |
0.139 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2240486.html