Information card for entry 2241090
| Common name |
β-<i>D,L</i>-fructose |
| Chemical name |
1,3,4,5,6-Pentahydroxyhexan-2-one |
| Formula |
C6 H12 O6 |
| Calculated formula |
C6 H12 O6 |
| SMILES |
OC[C@@]1(O)OC[C@@H](O)[C@@H](O)[C@@H]1O.OC[C@]1(O)OC[C@H](O)[C@H](O)[C@H]1O |
| Title of publication |
Crystal structure of β-<small>D</small>,<small>L</small>-fructose |
| Authors of publication |
Ishii, Tomohiko; Senoo, Tatsuya; Yoshihara, Akihide; Fukada, Kazuhiro; Sakane, Genta |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
10 |
| Pages of publication |
o719 - o720 |
| a |
5.43124 ± 0.00019 Å |
| b |
7.2727 ± 0.0003 Å |
| c |
10.1342 ± 0.0004 Å |
| α |
69.12 ± 0.002° |
| β |
83.907 ± 0.002° |
| γ |
78.381 ± 0.002° |
| Cell volume |
366.09 ± 0.03 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0404 |
| Residual factor for significantly intense reflections |
0.0368 |
| Weighted residual factors for significantly intense reflections |
0.0926 |
| Weighted residual factors for all reflections included in the refinement |
0.095 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241090.html