Information card for entry 2241211
| Chemical name |
1,2,3,5-di-<i>O</i>-Methylene-α-<i>D</i>-xylofuranose |
| Formula |
C7 H10 O5 |
| Calculated formula |
C7 H10 O5 |
| SMILES |
O1[C@@H]2COCO[C@@H]2[C@H]2OCO[C@@H]12 |
| Title of publication |
Crystal structure of 1,2,3,5-di-<i>O</i>-methylene-α-<small>D</small>-xylofuranose |
| Authors of publication |
Tiritiris, Ioannis; Tussetschläger, Stefan; Kantlehner, Willi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
11 |
| Pages of publication |
o889 |
| a |
8.5509 ± 0.0011 Å |
| b |
8.6327 ± 0.0011 Å |
| c |
20.057 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1480.6 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
20 |
| Hermann-Mauguin space group symbol |
C 2 2 21 |
| Hall space group symbol |
C 2c 2 |
| Residual factor for all reflections |
0.0396 |
| Residual factor for significantly intense reflections |
0.0328 |
| Weighted residual factors for significantly intense reflections |
0.0708 |
| Weighted residual factors for all reflections included in the refinement |
0.0738 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241211.html