Information card for entry 2241218
| Chemical name |
(2<i>E</i>,4<i>E</i>)-5-[Bis(2-hydroxyethyl)amino]-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-one |
| Formula |
C21 H22 Cl N O3 |
| Calculated formula |
C21 H22 Cl N O3 |
| SMILES |
Clc1ccc(C(=O)/C=C/C=C(/N(CCO)CCO)c2ccccc2)cc1 |
| Title of publication |
Crystal structure of (2<i>E</i>,4<i>E</i>)-5-[bis(2-hydroxyethyl)amino]-1-(4-chlorophenyl)-5-phenylpenta-2,4-dien-1-one |
| Authors of publication |
Golovanov, Alexander A.; Vologzhanina, Anna V.; Odin, Ivan S.; Tret'yakova, Tat'yana P.; Naumov, Sergey V. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2015 |
| Journal volume |
71 |
| Journal issue |
11 |
| Pages of publication |
o870 - o871 |
| a |
6.6258 ± 0.0001 Å |
| b |
11.0019 ± 0.0002 Å |
| c |
13.8592 ± 0.0003 Å |
| α |
110.98 ± 0.001° |
| β |
99.401 ± 0.002° |
| γ |
93.338 ± 0.001° |
| Cell volume |
923.14 ± 0.03 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0363 |
| Residual factor for significantly intense reflections |
0.0314 |
| Weighted residual factors for significantly intense reflections |
0.0877 |
| Weighted residual factors for all reflections included in the refinement |
0.0915 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.991 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241218.html