Information card for entry 2241664
| Chemical name |
<i>N</i>-(6,6-Diethoxyhexyl)-3,4,5-trimethoxybenzamide |
| Formula |
C20 H33 N O6 |
| Calculated formula |
C20 H33 N O6 |
| SMILES |
O(c1cc(cc(OC)c1OC)C(=O)NCCCCCC(OCC)OCC)C |
| Title of publication |
Crystal structures of three 3,4,5-trimethoxybenzamide-based derivatives |
| Authors of publication |
Gomes, Ligia R.; Low, John Nicolson; Oliveira, Catarina; Cagide, Fernando; Borges, Fernanda |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2016 |
| Journal volume |
72 |
| Journal issue |
5 |
| Pages of publication |
675 - 682 |
| a |
24.6345 ± 0.0018 Å |
| b |
8.4646 ± 0.0005 Å |
| c |
10.0598 ± 0.0007 Å |
| α |
90° |
| β |
100.851 ± 0.002° |
| γ |
90° |
| Cell volume |
2060.2 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0384 |
| Residual factor for significantly intense reflections |
0.0349 |
| Weighted residual factors for significantly intense reflections |
0.0921 |
| Weighted residual factors for all reflections included in the refinement |
0.095 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241664.html