Information card for entry 2241726
| Common name |
Dimethyl-3,4,5,6-tetraphenylcyclohexa-3,5-diene-1,2-dicarboxylate |
| Formula |
C34 H28 O4 |
| Calculated formula |
C34 H28 O4 |
| SMILES |
O=C(OC)[C@H]1C(=C(C(=C(c2ccccc2)[C@H]1C(=O)OC)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
Crystal structure of dimethyl 3,4,5,6-tetraphenylcyclohexa-3,5-diene-1,2-dicarboxylate |
| Authors of publication |
Greenberg, Fred H.; Nazarenko, Alexander Y. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2016 |
| Journal volume |
72 |
| Journal issue |
7 |
| Pages of publication |
947 - 950 |
| a |
10.833 ± 0.0012 Å |
| b |
10.833 ± 0.0012 Å |
| c |
39.169 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
3980.8 ± 0.8 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173.15 K |
| Number of distinct elements |
3 |
| Space group number |
145 |
| Hermann-Mauguin space group symbol |
P 32 |
| Hall space group symbol |
P 32 |
| Residual factor for all reflections |
0.035 |
| Residual factor for significantly intense reflections |
0.0334 |
| Weighted residual factors for significantly intense reflections |
0.0899 |
| Weighted residual factors for all reflections included in the refinement |
0.0914 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2241726.html